CAS 375-95-1: Perfluorononanoic acid
Description:Perfluorononanoic acid (PFNA) is a synthetic perfluoroalkyl substance (PFAS) characterized by a long carbon chain with nine carbon atoms, fully fluorinated, and terminated by a carboxylic acid group. Its chemical formula is C9HF17O2, and it is known for its hydrophobic and lipophobic properties, making it resistant to water and oil. PFNA is typically used in various industrial applications, including the production of fluoropolymers and as a surfactant in coatings and textiles. One of its notable characteristics is its persistence in the environment and biological systems, leading to concerns regarding its potential health effects, including endocrine disruption and developmental toxicity. PFNA is also subject to regulatory scrutiny due to its classification as a contaminant of emerging concern, prompting investigations into its environmental fate and human exposure. Its stability and resistance to degradation contribute to its accumulation in the environment, raising awareness about the need for alternatives and remediation strategies in managing PFAS contamination.
Formula:C9HF17O2
InChI:InChI=1S/C9HF17O2/c10-2(11,1(27)28)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h(H,27,28)
InChI key:InChIKey=UZUFPBIDKMEQEQ-UHFFFAOYSA-N
SMILES:O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononanoic acid
- C 1800
- Heptadecafluorononanoic Acid
- Nonanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-
- Nonanoic acid, heptadecafluoro-
- Perfluoro-n-nonanoic acid
- Perfluorononanoic acid
- Perfluoropelargonic acid
- Perfluorononan-1-oic acid
