CymitQuimica logo

CAS 37519-14-5

:

3-Hydroxyacetaminophen

Description:
3-Hydroxyacetaminophen, also known as paracetamol or acetaminophen, is a widely used analgesic and antipyretic agent. It is characterized by its ability to relieve pain and reduce fever, making it a common over-the-counter medication. The molecular structure features a hydroxyl group (-OH) and an acetaminophen moiety, which contribute to its pharmacological properties. This compound is typically administered orally and is well-absorbed in the gastrointestinal tract. It is metabolized primarily in the liver, where it undergoes conjugation to form non-toxic metabolites. 3-Hydroxyacetaminophen is generally considered safe when used at recommended doses, but overdose can lead to severe liver damage due to the accumulation of toxic metabolites. Its solubility in water and organic solvents allows for various formulations, including tablets, capsules, and liquid suspensions. Additionally, it has a relatively low potential for gastrointestinal irritation compared to non-steroidal anti-inflammatory drugs (NSAIDs), making it a preferred choice for many patients. Overall, 3-Hydroxyacetaminophen is an essential medication in pain management and fever reduction.
Formula:C8H9NO3
InChI:InChI=1S/C8H9NO3/c1-5(10)9-6-2-3-7(11)8(12)4-6/h2-4,11-12H,1H3,(H,9,10)
InChI key:InChIKey=IPFBMHOMTSBTSU-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=CC(O)=C(O)C=C1
Synonyms:
  • 3-Hydroxyacetaminophen
  • 4-(Acetylamino)catechol
  • 4-Acetylaminopyrocatechol
  • Acetamide, N-(3,4-dihydroxyphenyl)-
  • Acetanilide, 3′,4′-dihydroxy-
  • N-(3,4-Dihydroxyphenyl)acetamide
Found 9 products.