CymitQuimica logo

CAS 37527-48-3

:

8H-Purin-8-one, 6-chloro-1,7-dihydro-

Description:
8H-Purin-8-one, 6-chloro-1,7-dihydro- (CAS 37527-48-3) is a purine derivative characterized by its bicyclic structure, which includes a fused imidazole and pyrimidine ring. This compound features a chlorine atom at the 6-position, which can influence its reactivity and biological activity. The presence of the carbonyl group at the 8-position contributes to its classification as a purinone. Typically, purine derivatives exhibit significant biological activity, often acting as nucleobases or serving as precursors in nucleic acid synthesis. The dihydro form indicates that the compound has two hydrogen atoms added to the ring structure, which may affect its stability and solubility. Such compounds are of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which the compound is studied.
Formula:C5H3ClN4O
InChI:InChI=1S/C5H3ClN4O/c6-3-2-4(8-1-7-3)10-5(11)9-2/h1H,(H2,7,8,9,10,11)
InChI key:DCOLIWSXJIHGOF-UHFFFAOYSA-N
SMILES:C1=NC2=C(C(=N1)Cl)NC(=O)N2
Found 6 products.