CymitQuimica logo

CAS 3756-40-9

:

Benzene, (1-bromoethyl)-, (S)-

Description:
Benzene, (1-bromoethyl)-, (S)-, also known as (S)-1-bromoethylbenzene, is an organic compound characterized by a bromine atom attached to a 1-ethyl group on a benzene ring. This compound is a chiral molecule, meaning it has non-superimposable mirror images, which is indicated by the (S) configuration. It typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. The presence of the bromine atom introduces reactivity, making it a useful intermediate in organic synthesis, particularly in the formation of other brominated compounds or in substitution reactions. Its solubility is generally limited in water but it is soluble in organic solvents such as ethanol and ether. The compound's physical and chemical properties, including boiling point, melting point, and density, can vary based on purity and environmental conditions. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested, and it is advisable to consult material safety data sheets (MSDS) for detailed handling and storage guidelines.
Formula:C8H9Br
InChI:InChI=1S/C8H9Br/c1-7(9)8-5-3-2-4-6-8/h2-7H,1H3/t7-/m0/s1
InChI key:CRRUGYDDEMGVDY-ZETCQYMHSA-N
SMILES:C[C@@H](C1=CC=CC=C1)Br
Found 2 products.