CAS 37566-39-5
:2-Amino-5-Bromo-1,3,4-Thiadiazole
Description:
2-Amino-5-Bromo-1,3,4-Thiadiazole is a heterocyclic compound characterized by the presence of a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom within a five-membered ring structure. This compound features an amino group (-NH2) and a bromo substituent (-Br) at specific positions on the ring, contributing to its reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The presence of the amino group allows for hydrogen bonding, which can influence its interactions in biological systems and chemical reactions. 2-Amino-5-Bromo-1,3,4-Thiadiazole is of interest in medicinal chemistry and materials science due to its potential as a building block for pharmaceuticals and agrochemicals. Its unique structural features may also impart specific biological activities, making it a subject of research in various fields, including drug development and synthesis of novel compounds. Safety and handling precautions should be observed, as with many halogenated and nitrogen-containing compounds.
Formula:C2H2BrN3S
InChI:InChI=1/C2H2BrN3S/c3-1-5-6-2(4)7-1/h(H2,4,6)
SMILES:c1(Br)n[nH]c(=N)s1
Synonyms:- 1,3,4-Thiadiazol-2-amine, 5-bromo-
- 5-Bromo-1,3,4-thiadiazol-2-amine
- 2-Amino-5-Bromo-[1,3,4]Thiadiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-5-bromo-1,3,4-thiadiazole
CAS:Formula:C2H2BrN3SPurity:95%Color and Shape:SolidMolecular weight:180.02645-Bromo-1,3,4-thiadiazol-2-ylamine
CAS:Formula:C2H2BrN3SPurity:99.0%Color and Shape:SolidMolecular weight:180.022-Amino-5-bromo-1,3,4-thiadiazole
CAS:2-Amino-5-bromo-1,3,4-thiadiazoleFormula:C2H2BrN3SPurity:≥95%Color and Shape: dark brown powderMolecular weight:180.03g/mol5-Bromo-1,3,4-thiadiazol-2-amine
CAS:<p>5-Bromo-1,3,4-thiadiazol-2-amine is a synthetic antiplatelet agent that belongs to the thiosemicarbazide class. It has been shown to have broad-spectrum antimicrobial activity against Gram-positive and Gram-negative bacteria. 5-Bromo-1,3,4-thiadiazol-2-amine is an orally bioavailable drug that can be used in the treatment of bacterial infections caused by Gram negative bacteria. The molecular modeling study suggests that this compound binds to the enzyme active site of DNA gyrase and inhibits its activity. 5Bromo-1,3,4-thiadiazol-2 amine is deuterated and can be used for molecular modeling studies because it is soluble in organic solvents.</p>Formula:C2H2BrN3SPurity:Min. 95%Color and Shape:PowderMolecular weight:180.03 g/mol



