CAS 376-06-7: Perfluorotetradecanoic acid
Description:Perfluorotetradecanoic acid (PFTeDA), with the CAS number 376-06-7, is a perfluorinated carboxylic acid characterized by a long carbon chain of 14 carbon atoms, fully fluorinated. This compound is part of a larger class of perfluoroalkyl substances (PFAS), known for their unique properties, including high thermal and chemical stability, as well as resistance to degradation in the environment. PFTeDA is typically a solid at room temperature and exhibits low surface tension, making it useful in various applications, including surfactants and coatings. Its hydrophobic and lipophobic characteristics contribute to its effectiveness in repelling water and oils. However, like many PFAS, PFTeDA raises environmental and health concerns due to its persistence in the environment and potential bioaccumulation in living organisms. Regulatory scrutiny has increased regarding its use and disposal, prompting research into safer alternatives and remediation strategies. Overall, while PFTeDA has valuable industrial applications, its environmental impact necessitates careful management and consideration.
Formula:C14HF27O2
InChI:InChI=1S/C14HF27O2/c15-2(16,1(42)43)3(17,18)4(19,20)5(21,22)6(23,24)7(25,26)8(27,28)9(29,30)10(31,32)11(33,34)12(35,36)13(37,38)14(39,40)41/h(H,42,43)
InChI key:InChIKey=RUDINRUXCKIXAJ-UHFFFAOYSA-N
SMILES:O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-Heptacosafluorotetradecanoic acid
- PFTeDA
- Perfluoro-n-tetradecanoic acid
- Perfluoromyristic acid
- Perfluorotetradecanecarboxylic acid
- Perfluorotetradecanoic acid
- Tetradecanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-heptacosafluoro-
- Tetradecanoic acid, heptacosafluoro-
