CymitQuimica logo

CAS 376609-66-4

:

Phenol, 2-methoxy-4-(1H-tetrazol-5-yl)-

Description:
Phenol, 2-methoxy-4-(1H-tetrazol-5-yl)-, also known by its CAS number 376609-66-4, is an organic compound characterized by the presence of a phenolic group, a methoxy group, and a tetrazole moiety. This compound typically exhibits properties associated with both phenols and heterocyclic compounds. The phenolic structure contributes to its potential as an antioxidant and its ability to participate in hydrogen bonding, while the tetrazole ring may impart unique reactivity and biological activity. The methoxy group enhances the solubility of the compound in organic solvents and can influence its electronic properties. In terms of applications, compounds with similar structures are often explored for their pharmacological properties, including antimicrobial and anti-inflammatory activities. The presence of the tetrazole ring is particularly noteworthy, as it is known to enhance the bioactivity of various pharmaceuticals. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and materials science.
Formula:C8H8N4O2
InChI:InChI=1S/C8H8N4O2/c1-14-7-4-5(2-3-6(7)13)8-9-11-12-10-8/h2-4,13H,1H3,(H,9,10,11,12)
InChI key:ODAXBFZKBKYTGD-UHFFFAOYSA-N
SMILES:COC1=C(C=CC(=C1)C2=NNN=N2)O
Found 4 products.