CymitQuimica logo

CAS 37674-57-0

:

3-Ethyl-3-(methacryloyloxymethyl)oxetane

Description:
3-Ethyl-3-(methacryloyloxymethyl)oxetane is a chemical compound characterized by its oxetane ring structure, which contributes to its unique reactivity and properties. This compound features an ethyl group and a methacryloyloxymethyl substituent, making it a versatile monomer in polymer chemistry. It is typically a colorless to pale yellow liquid with a moderate viscosity. The presence of the methacrylate functional group allows for easy polymerization, particularly through free radical mechanisms, making it useful in the production of various polymers and copolymers. Its reactivity can be influenced by factors such as temperature and the presence of initiators. Additionally, 3-Ethyl-3-(methacryloyloxymethyl)oxetane exhibits good thermal stability and can be utilized in applications such as coatings, adhesives, and sealants. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose health risks upon exposure. Overall, this compound is significant in the field of materials science and polymer engineering.
Formula:C10H16O3
InChI:InChI=1S/C10H16O3/c1-4-10(5-12-6-10)7-13-9(11)8(2)3/h2,4-7H2,1,3H3
InChI key:RSHKWPIEJYAPCL-UHFFFAOYSA-N
SMILES:CCC1(COC1)COC(=O)C(=C)C
Found 4 products.