
CAS 37729-25-2
:3,5-Dibromo-2,6-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]-4-pyridinamine
Description:
3,5-Dibromo-2,6-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]-4-pyridinamine is a complex organic compound characterized by its multiple halogen substituents and a nitro group. The presence of bromine and fluorine atoms contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The pyridinamine structure suggests that it may exhibit basic properties due to the nitrogen atom in the pyridine ring. This compound is likely to be a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals, given its structural features that may interact with biological targets. The nitro group can enhance reactivity, while the trifluoromethyl group may influence the compound's electronic properties. Additionally, the presence of multiple halogens can affect the compound's stability and solubility in various solvents. Overall, this compound's intricate structure and functional groups make it a subject of interest for further research in medicinal chemistry and material science.
Formula:C12H4Br2F5N3O2
InChI:InChI=1S/C12H4Br2F5N3O2/c13-7-9(8(14)11(16)21-10(7)15)20-6-2-1-4(22(23)24)3-5(6)12(17,18)19/h1-3H,(H,20,21)
InChI key:InChIKey=WPYUJENCPSWGCF-UHFFFAOYSA-N
SMILES:N(C1=C(C(F)(F)F)C=C(N(=O)=O)C=C1)C=2C(Br)=C(F)N=C(F)C2Br
Synonyms:- 4-Pyridinamine, 3,5-dibromo-2,6-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]-
- 3,5-Dibromo-2,6-difluoro-N-[4-nitro-2-(trifluoromethyl)phenyl]-4-pyridinamine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3,5-Dibromo-2,6-difluoro-N-(4-nitro-2-(trifluoromethyl)phenyl)pyridin-4-amine
CAS:Formula:C12H4Br2F5N3O2Molecular weight:476.9791
