CAS 37739-05-2: CCPA
Description:CCPA, or 2-(4-chlorophenyl)-2-(pyridin-2-yl)acetic acid, is a chemical compound characterized by its unique structure that includes a chlorophenyl group and a pyridine moiety. This compound is often studied for its potential pharmacological properties, particularly in the context of its role as a ligand in various biological systems. CCPA is known to interact with specific receptors, which may influence physiological processes. Its molecular structure contributes to its solubility and reactivity, making it of interest in medicinal chemistry and drug development. Additionally, CCPA's stability under standard laboratory conditions allows for its use in various experimental settings. Safety data sheets typically recommend handling it with care, as with many chemical substances, due to potential toxicity or environmental impact. Overall, CCPA represents a significant compound in the field of organic chemistry and pharmacology, warranting further investigation into its applications and effects.
Formula:C15H20ClN5O4
InChI:InChI=1S/C15H20ClN5O4/c16-15-19-12(18-7-3-1-2-4-7)9-13(20-15)21(6-17-9)14-11(24)10(23)8(5-22)25-14/h6-8,10-11,14,22-24H,1-5H2,(H,18,19,20)/t8-,10-,11-,14-/m1/s1
InChI key:InChIKey=XSMYYYQVWPZWIZ-IDTAVKCVSA-N
SMILES:ClC=1N=C(NC2CCCC2)C=3N=CN(C3N1)C4OC(CO)C(O)C4O
- Synonyms:
- (2R,3R,4S,5R)-2-[2-Chloro-6-(cyclopentylamino)-9H-purin-9-yl]-5-(hydroxymethyl)tetrahydrofuran-3,4-diol
- 2-Chloro-N(6)cyclopentyladenosine
- 2-Chloro-N<sup>6</sup>-cyclopentyladenosine
- 2-chloro-N-cyclopentyladenosine
- Adenosine, 2-chloro-N-cyclopentyl-
- Brn 4888162
- CCPA
- 2-Chloro-N6-cyclopentyladenosine
- 2-Chloro-N6-cyclopentyladenosine
