CymitQuimica logo

CAS 378-16-5

:

2,2,3,3,3-pentafluoropropyl methyl ether

Description:
2,2,3,3,3-Pentafluoropropyl methyl ether, with the CAS number 378-16-5, is a fluorinated ether characterized by its unique structure that includes a propyl backbone with five fluorine atoms and a methyl ether functional group. This compound is typically a colorless liquid at room temperature and exhibits low volatility. Its high fluorine content imparts significant chemical stability and low reactivity, making it resistant to oxidation and hydrolysis. The presence of fluorine also contributes to its low surface tension and high lipophobicity, which can be advantageous in various applications, including as a solvent or in specialty chemical formulations. Additionally, 2,2,3,3,3-pentafluoropropyl methyl ether has a relatively low boiling point compared to other ethers, which can influence its behavior in different chemical processes. However, due to its fluorinated nature, it is essential to handle this compound with care, considering potential environmental and health impacts associated with fluorinated substances.
Formula:C4H5F5O
InChI:InChI=1/C4H5F5O/c1-10-2-3(5,6)4(7,8)9/h2H2,1H3
InChI key:ZYAMKYAPIQPWQR-UHFFFAOYSA-N
SMILES:COCC(C(F)(F)F)(F)F
Synonyms:
  • 1,1,1,2,2-Pentafluoro-3-Methoxypropane
Found 3 products.