CymitQuimica logo

CAS 37859-28-2

:

4-(1,3-benzothiazol-2-ylmethyl)aniline

Description:
4-(1,3-benzothiazol-2-ylmethyl)aniline, with the CAS number 37859-28-2, is an organic compound characterized by its structure, which includes a benzothiazole moiety linked to an aniline group. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in various fields, including pharmaceuticals and materials science. The presence of both the benzothiazole and aniline functional groups suggests that it may exhibit biological activity, possibly serving as a precursor or intermediate in the synthesis of more complex molecules. Additionally, it may possess certain solubility characteristics in organic solvents, which can influence its reactivity and interaction with other chemical species. The compound's stability, reactivity, and potential toxicity would need to be evaluated in specific contexts, particularly if used in industrial or laboratory settings. Overall, 4-(1,3-benzothiazol-2-ylmethyl)aniline represents a versatile chemical structure with implications in various chemical research and applications.
Formula:C14H12N2S
InChI:InChI=1/C14H12N2S/c15-11-7-5-10(6-8-11)9-14-16-12-3-1-2-4-13(12)17-14/h1-8H,9,15H2
InChI key:GUUPKXREMJGASF-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)nc(Cc1ccc(cc1)N)s2
Found 4 products.