CymitQuimica logo

CAS 37937-62-5

:

5-Phenyl-1,2,4-oxadiazole-3-carboxylic acid

Description:
5-Phenyl-1,2,4-oxadiazole-3-carboxylic acid is an organic compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a phenyl group attached to the oxadiazole ring, contributing to its aromatic properties. The carboxylic acid functional group (-COOH) at the 3-position of the oxadiazole ring imparts acidic characteristics, making it capable of participating in various chemical reactions, such as esterification and amidation. The presence of both the phenyl group and the carboxylic acid enhances its potential for applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the compound may exhibit interesting biological activities, which can be explored for medicinal chemistry purposes. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions, making it a subject of interest for further research in organic synthesis and functional material development.
Formula:C9H6N2O3
InChI:InChI=1S/C9H6N2O3/c12-9(13)7-10-8(14-11-7)6-4-2-1-3-5-6/h1-5H,(H,12,13)
InChI key:FBWZBUNNSOZSSJ-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=NC(=NO2)C(=O)O
Found 4 products.