CAS 380315-80-0
:N-[(4-acetamidophenyl)carbamothioyl]-4-tert-butylbenzamide
Description:
N-[(4-acetamidophenyl)carbamothioyl]-4-tert-butylbenzamide is a chemical compound characterized by its complex structure, which includes an acetamidophenyl group, a carbamothioyl moiety, and a tert-butylbenzamide component. This compound features a thioamide functional group, which is known for its potential biological activity, including antimicrobial and anticancer properties. The presence of the tert-butyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The acetamido group may contribute to the compound's ability to form hydrogen bonds, affecting its interactions with biological targets. Additionally, the compound's molecular structure suggests it may exhibit specific pharmacological activities, making it of interest in medicinal chemistry. Its CAS number, 380315-80-0, allows for easy identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. Overall, this compound represents a unique combination of functional groups that may be explored for various chemical and biological applications.
Formula:C20H23N3O2S
InChI:InChI=1S/C20H23N3O2S/c1-13(24)21-16-9-11-17(12-10-16)22-19(26)23-18(25)14-5-7-15(8-6-14)20(2,3)4/h5-12H,1-4H3,(H,21,24)(H2,22,23,25,26)
SMILES:CC(=Nc1ccc(cc1)N=C(N=C(c1ccc(cc1)C(C)(C)C)O)S)O
Synonyms:- Tenovin-1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Tenovin-1
CAS:N-((4-Acetamidophenyl)carbamothioyl)-4-(tert-butyl)benzamideFormula:C20H23N3O2SPurity:98%Molecular weight:369.48Tenovin-1
CAS:Formula:C20H23N3O2SPurity:>93.0%(HPLC)(qNMR)Color and Shape:White to Light yellow powder to crystalMolecular weight:369.48Tenovin-1
CAS:Tenovin-1 inhibits protein-deacetylating activities of SirT1 and SirT2 and protects against MDM2-mediated p53 degradation, which involves ubiquitination.Formula:C20H23N3O2SPurity:99.33%Color and Shape:SolidMolecular weight:369.48Tenovin 1
CAS:Controlled ProductApplications Tenovin 1 is a sirtuin inhibitor.
References McCarthy, A.R., et. al.: Bioorg. Med. Chem., 20, 1779 (2012)Formula:C20H23N3O2SColor and Shape:NeatMolecular weight:369.48Tenovin-1
CAS:Tenovin-1 is a sirtuin inhibitor that has been shown to inhibit the enzyme SIRT2, which is involved in the regulation of cellular response to oxidative stress. Tenovin-1 is also an inhibitor of viral DNA methyltransferases and may be useful for the treatment of skin cancer, as well as other cancers. Tenovin-1 inhibits protein synthesis and induces autophagy through mitochondrial membrane depolarization. Tenovin-1 has been clinically tested for safety and efficacy in humans with skin cancer and shows promise for clinical relevance.Formula:C20H23N3O2SPurity:Min. 95%Molecular weight:369.48 g/mol







