CymitQuimica logo

CAS 380381-28-2

:

Methyl 4-iodopyridine-2-carboxylate

Description:
Methyl 4-iodopyridine-2-carboxylate is an organic compound characterized by its pyridine ring, which is substituted at the 4-position with an iodine atom and at the 2-position with a carboxylate group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its role as an intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The presence of the iodine atom enhances its reactivity, making it useful in nucleophilic substitution reactions. Additionally, the carboxylate group contributes to its solubility in polar solvents, facilitating its use in various chemical reactions. Methyl 4-iodopyridine-2-carboxylate is also notable for its potential applications in medicinal chemistry, where it may serve as a building block for more complex molecules. As with many halogenated compounds, it is important to handle this substance with care due to potential toxicity and environmental concerns.
Formula:C7H6INO2
InChI:InChI=1/C7H6INO2/c1-11-7(10)6-4-5(8)2-3-9-6/h2-4H,1H3
InChI key:HSNLSLNACLYWKJ-UHFFFAOYSA-N
SMILES:COC(=O)c1cc(ccn1)I
Synonyms:
  • 2-Pyridinecarboxylic Acid, 4-Iodo-, Methyl Ester
Found 4 products.