CymitQuimica logo

CAS 380482-30-4

:

2,9-Dimethyl-N-(2,4,6-trinitrophenyl)-1,10-phenanthrolin-5-amine

Description:
2,9-Dimethyl-N-(2,4,6-trinitrophenyl)-1,10-phenanthrolin-5-amine is a chemical compound characterized by its complex structure, which includes a phenanthroline core substituted with both methyl groups and a trinitrophenyl moiety. This compound typically exhibits properties associated with both aromatic and nitrogen-containing compounds, such as potential fluorescence and the ability to form coordination complexes with metal ions. The presence of the trinitrophenyl group suggests that it may possess explosive or sensitive characteristics, as nitro groups are known for their energetic properties. Additionally, the amine functional group can participate in hydrogen bonding and may influence the compound's solubility and reactivity. The compound's molecular structure allows for various applications in fields such as materials science, analytical chemistry, and potentially in the development of sensors or probes due to its unique electronic properties. Safety precautions should be taken when handling this compound, considering its potential hazards associated with the nitro groups.
Formula:C20H14N6O6
InChI:InChI=1S/C20H14N6O6/c1-10-3-5-12-7-15(14-6-4-11(2)22-19(14)18(12)21-10)23-20-16(25(29)30)8-13(24(27)28)9-17(20)26(31)32/h3-9,23H,1-2H3
InChI key:InChIKey=YMWCRDXLDDCILP-UHFFFAOYSA-N
SMILES:N(C1=C2C(=C3C(=C1)C=CC(C)=N3)N=C(C)C=C2)C4=C(N(=O)=O)C=C(N(=O)=O)C=C4N(=O)=O
Synonyms:
  • 1,10-phenanthrolin-5-amine, 2,9-dimethyl-N-(2,4,6-trinitrophenyl)-
  • 2,9-Dimethyl-5-picrylamino-1,10-phenanthroline
  • 2,9-Dimethyl-N-(2,4,6-trinitrophenyl)-1,10-phenanthrolin-5-amine
  • 2,9-Dimethyl-N-(2,4,6-trinitrophenyl)-1,10-phenanthrolin-5-amine
Found 4 products.