CAS 380594-11-6
:5-(2-Chloro-4-nitrophenyl)-2-furoyl chloride
Description:
5-(2-Chloro-4-nitrophenyl)-2-furoyl chloride is an organic compound characterized by its furoyl chloride structure, which includes a furan ring and a chlorinated nitrophenyl substituent. This compound typically appears as a yellow to orange solid or liquid, depending on its purity and form. It is known for its reactivity due to the presence of the acyl chloride functional group, which makes it a useful intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The chlorinated and nitro substituents on the phenyl ring contribute to its electrophilic properties, enhancing its ability to participate in nucleophilic substitution reactions. Additionally, this compound may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures during its use in laboratory or industrial settings. Its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water. Overall, 5-(2-Chloro-4-nitrophenyl)-2-furoyl chloride is a valuable compound in synthetic organic chemistry.
Formula:C11H5Cl2NO4
InChI:InChI=1/C11H5Cl2NO4/c12-8-5-6(14(16)17)1-2-7(8)9-3-4-10(18-9)11(13)15/h1-5H
SMILES:c1cc(c(cc1N(=O)=O)Cl)c1ccc(C(=O)Cl)o1
Synonyms:- 2-Furancarbonyl Chloride, 5-(2-Chloro-4-Nitrophenyl)-
- 5-(2-Chloro-4-Nitrophenyl)Furan-2-Carbonyl Chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
