CymitQuimica logo

CAS 3816-66-8

:

3-hydroxy-4-methylbenzonitrile

Description:
3-Hydroxy-4-methylbenzonitrile, with the CAS number 3816-66-8, is an organic compound characterized by the presence of a hydroxyl group (-OH) and a nitrile group (-C≡N) attached to a benzene ring that also contains a methyl group (-CH₃). This compound typically appears as a solid at room temperature and is soluble in polar organic solvents due to the hydroxyl group, which can engage in hydrogen bonding. The presence of the nitrile group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and substitutions. The compound's structure allows for potential applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis. Its physical properties, such as melting point and boiling point, can vary based on purity and specific conditions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C8H7NO
InChI:InChI=1/C8H7NO/c1-6-2-3-7(5-9)4-8(6)10/h2-4,10H,1H3
InChI key:UXNPMDKLHYMKBZ-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1O)C#N
Synonyms:
  • 4-Formyl-3-Hydroxybenzonitrile
  • Benzonitrile, 4-formyl-3-hydroxy-
  • Benzonitrile, 3-hydroxy-4-methyl-
Found 4 products.