CymitQuimica logo

CAS 381670-32-2

:

(2R)-1-Ethyl-2-pyrrolidinecarboxamide

Description:
(2R)-1-Ethyl-2-pyrrolidinecarboxamide, with the CAS number 381670-32-2, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features an ethyl group attached to the nitrogen atom of the pyrrolidine ring and a carboxamide functional group, which contributes to its polar nature and potential solubility in polar solvents. The presence of the chiral center at the second carbon atom indicates that this compound can exist in two enantiomeric forms, with the (R) configuration being specified. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrrolidine derivatives. The compound's properties, such as melting point, boiling point, and specific reactivity, would depend on its interactions with other molecules and its environment. As with many amides, it may exhibit hydrogen bonding capabilities, influencing its solubility and stability in various conditions.
Formula:C7H14N2O
InChI:InChI=1S/C7H14N2O/c1-2-9-5-3-4-6(9)7(8)10/h6H,2-5H2,1H3,(H2,8,10)/t6-/m1/s1
InChI key:InChIKey=LQOASEHNECNLNM-ZCFIWIBFSA-N
SMILES:C(C)N1[C@@H](C(N)=O)CCC1
Synonyms:
  • 2-Pyrrolidinecarboxamide, 1-ethyl-, (2R)-
  • (2R)-1-Ethyl-2-pyrrolidinecarboxamide
  • N-Ethyl-D-prolinamide
  • (R)-1-Ethylpyrrolidine-2-carboxamide
  • 2-Pyrrolidinecarboxamide,1-ethyl-,(2R)-(9CI)
Found 4 products.