CAS 38172-19-9
:(indan-1,3-diylidene)dimalononitrile
Description:
Indan-1,3-diylidene)dimalononitrile, with the CAS number 38172-19-9, is an organic compound characterized by its unique structure, which features an indan moiety connected to two malononitrile groups. This compound typically exhibits properties associated with conjugated systems, such as enhanced stability and potential for electronic applications due to its ability to participate in π-π stacking interactions. It is often studied for its potential use in organic electronics, particularly in organic light-emitting diodes (OLEDs) and photovoltaic cells, owing to its ability to absorb light and facilitate charge transport. The presence of the malononitrile groups contributes to its electron-withdrawing characteristics, which can enhance its reactivity and solubility in various organic solvents. Additionally, the compound may display interesting optical properties, including fluorescence, making it a candidate for further research in materials science and photonics. Overall, its unique structural features and electronic properties make it a subject of interest in the field of organic chemistry and materials development.
Formula:C15H6N4
InChI:InChI=1/C15H6N4/c16-6-10(7-17)14-5-15(11(8-18)9-19)13-4-2-1-3-12(13)14/h1-4H,5H2
SMILES:c1ccc2c(c1)C(=C(C#N)C#N)CC2=C(C#N)C#N
Synonyms:- 1,3-Bis(dicyanomethylidene)indan
- 2,2'-(1H-indene-1,3(2H)-diylidene)dipropanedinitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,3-Bis(dicyanomethylidene)indan
CAS:Formula:C15H6N4Purity:>98.0%(HPLC)(N)Color and Shape:White to Gray to Brown powder to crystalMolecular weight:242.241,3-Bis(dicyanomethylidene)indan
CAS:1,3-Bis(dicyanomethylidene)indanFormula:C15H6N4Purity:97%Molecular weight:242.231,3-Bis(dicyanomethylidene)indan
CAS:Formula:C15H6N4Purity:97%Color and Shape:SolidMolecular weight:242.23491,3-Bis(dicyanomethylidene)indan
CAS:1,3-Bis(dicyanomethylidene)indan is a supramolecular dye that has been shown to form complexes with a variety of acceptors. The interaction between the dye and the acceptor is determined by the dipole moment, polarity, and electron affinity of the two molecules. 1,3-Bis(dicyanomethylidene)indan has been shown to interact with viologen and anion donors as well as organic dyes such as methylene blue. 1,3-Bis(dicyanomethylidene)indan has also been used in optical devices such as light emitting diodes (LEDs).
Formula:C15H6N4Purity:Min. 95%Color and Shape:PowderMolecular weight:242.24 g/mol





