CymitQuimica logo

CAS 3819-88-3

:

1-fluoro-3-iodo-5-nitrobenzene

Description:
1-Fluoro-3-iodo-5-nitrobenzene is an aromatic compound characterized by the presence of a fluorine atom, an iodine atom, and a nitro group attached to a benzene ring. The molecular structure features a benzene core with substituents at the 1, 3, and 5 positions, which influences its chemical reactivity and physical properties. This compound is typically a solid at room temperature and may exhibit a yellow to brown color. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the nitro group contributes to its electrophilic character, making it a useful intermediate in various chemical reactions. Additionally, the halogen substituents (fluorine and iodine) can enhance its reactivity and solubility in organic solvents. Safety considerations should be taken into account when handling this compound, as it may pose health risks due to its halogenated nature and nitro group. Proper storage and disposal methods are essential to mitigate any environmental impact.
Formula:C6H3FINO2
InChI:InChI=1/C6H3FINO2/c7-4-1-5(8)3-6(2-4)9(10)11/h1-3H
InChI key:MXPYCSFCKXSPAB-UHFFFAOYSA-N
SMILES:c1c(cc(cc1I)N(=O)=O)F
Synonyms:
  • 3-Nitro-5-fluoro-iodo-benzene
  • 3-Fluoro-5-Iodonitrobenzene
Found 5 products.