CAS 38205-55-9

1-(4-methyl-1,3-thiazol-5-yl)ethanone

Description:

1-(4-Methyl-1,3-thiazol-5-yl)ethanone, with the CAS number 38205-55-9, is an organic compound characterized by its thiazole ring structure, which contributes to its unique chemical properties. This compound features a ketone functional group, specifically an ethanone moiety, attached to a thiazole ring that contains a methyl substituent. The presence of the thiazole ring imparts notable biological activity, making it of interest in pharmaceutical and agrochemical research. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential reactivity due to the presence of the carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. Additionally, the thiazole ring can engage in interactions such as hydrogen bonding and π-π stacking, influencing its behavior in biological systems. Overall, 1-(4-methyl-1,3-thiazol-5-yl)ethanone is a compound of interest due to its structural features and potential applications in various fields.

Formula: C₆H₇NOS

InChI: InChI=1/C6H7NOS/c1-4-6(5(2)8)9-3-7-4/h3H,1-2H3

SMILES: Cc1c(C(=O)C)scn1

Synonyms:

• Ethanone, 1-(4-Methyl-5-Thiazolyl)-
• 4-Methyl-5-acetyl thiazole
• 5-Acetyl-4-methylthiazole

4-Methyl-5-Acetyl Thiazole

CAS: 38205-55-9

Formula: C₆H₇NOS

Purity: 95%

Color and Shape: Solid

Molecular weight: 141.1909

Ref: IN-DA00C8FS

1-(4-Methylthiazol-5-yl)ethan-1-one

CAS: 38205-55-9

1-(4-Methylthiazol-5-yl)ethan-1-one

Purity: 98%

Molecular weight: 141.19g/mol

Ref: 54-OR94318

1-(4-Methylthiazol-5-yl)ethanone

CAS: 38205-55-9

Formula: C₆H₇NOS

Purity: 95%

Molecular weight: 141.19

Ref: 10-F224536