CAS 38205-55-9

1-(4-methyl-1,3-thiazol-5-yl)ethanone

Description:

1-(4-Methyl-1,3-thiazol-5-yl)ethanone, with the CAS number 38205-55-9, is an organic compound characterized by its thiazole ring structure, which contributes to its unique chemical properties. This compound features a ketone functional group, specifically an ethanone moiety, attached to a thiazole ring that contains a methyl substituent. The presence of the thiazole ring imparts notable biological activity, making it of interest in pharmaceutical and agrochemical research. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential reactivity due to the presence of the carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. Additionally, the thiazole ring can engage in interactions such as hydrogen bonding and π-π stacking, influencing its behavior in biological systems. Overall, 1-(4-methyl-1,3-thiazol-5-yl)ethanone is a compound of interest due to its structural features and potential applications in various fields.

Formula: C₆H₇NOS

InChI: InChI=1/C6H7NOS/c1-4-6(5(2)8)9-3-7-4/h3H,1-2H3

InChI key: MBLHLRLBSIWLMG-UHFFFAOYSA-N

SMILES: Cc1c(C(=O)C)scn1

Synonyms:

• Ethanone, 1-(4-Methyl-5-Thiazolyl)-
• 4-Methyl-5-acetyl thiazole
• 5-Acetyl-4-methylthiazole

1-(4-Methylthiazol-5-yl)ethan-1-one

CAS: 38205-55-9

1-(4-Methylthiazol-5-yl)ethan-1-one

Formula: C₆H₇NOS

Purity: 98%

Molecular weight: 141.19

Ref: 54-OR94318

1-(4-Methyl-1,3-Thiazol-5-yl)Ethanone

CAS: 38205-55-9

Formula: C₆H₇NOS

Purity: 95%

Color and Shape: Solid

Molecular weight: 141.1909

Ref: IN-DA00C8FS

1-(4-Methylthiazol-5-yl)ethanone

CAS: 38205-55-9

Formula: C₆H₇NOS

Purity: 95%

Molecular weight: 141.19

Ref: 10-F224536

CYP2E1 inhibitor Q11

CAS: 38205-55-9

1-(4-Methylthiazol-5-yl)ethanone

Formula: C₆H₇NOS

Purity: 95%

Molecular weight: 141.19

Ref: IN-DG98911

CYP2E1-IN-1

CAS: 38205-55-9

CYP2E1-IN-1 (Compound 10) is an orally active inhibitor of cytochrome P450 2E1 (CYP2E1) with a dissociation constant (Kd) of 7.02 μM, an IC₅₀ of 1.64 μM, and a Ki of 0.897 μM. It alleviates pancreatic damage by activating the Nrf2/HO-1 signaling pathway and inhibiting ROS production. CYP2E1-IN-1 demonstrates significant anti-inflammatory and antioxidant properties, effectively reducing inflammation and oxidative stress in severe acute pancreatitis (SAP). It is suitable for the study of SAP and other inflammation-related conditions.

Formula: C₆H₇NOS

Molecular weight: 141.191

Ref: TM-T207656