CymitQuimica logo

CAS 382150-50-7

:

1-Hexyl-3-methylimidazolium Bis(trifluoromethanesulfonyl)imide

Description:
1-Hexyl-3-methylimidazolium bis(trifluoromethanesulfonyl)imide, commonly referred to as [C6mim][Tf2N], is an ionic liquid characterized by its low volatility, high thermal stability, and excellent solvation properties. It features a hexyl alkyl chain and a methyl group on the imidazolium ring, contributing to its unique properties. The bis(trifluoromethanesulfonyl)imide anion is known for its weak hydrogen bonding and high ionic conductivity, making this ionic liquid suitable for various applications, including electrochemistry and as a solvent for organic reactions. Its low viscosity enhances mass transport properties, while its non-volatile nature makes it an environmentally friendly alternative to traditional organic solvents. Additionally, [C6mim][Tf2N] exhibits good thermal stability, typically remaining stable at elevated temperatures, which is advantageous for high-temperature applications. Overall, this compound is notable for its tunable properties, allowing for customization in various chemical processes and applications in fields such as catalysis, energy storage, and separation technologies.
Formula:C12H19F6N3O4S2
InChI:InChI=1S/C10H19N2.C2F6NO4S2/c1-3-4-5-6-7-12-9-8-11(2)10-12;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h8-10H,3-7H2,1-2H3;/q+1;-1
InChI key:RCNFOZUBFOFJKZ-UHFFFAOYSA-N
SMILES:CCCCCCN1C=C[N+](=C1)C.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F
Synonyms:
  • 1-Hexyl-3-Methylimidazolium Bis(Trifluoromethylsulfonyl)Imide
Found 5 products.