CAS 38233-47-5
:2,3,4-trifluoro-5-methoxybenzoic acid
Description:
2,3,4-Trifluoro-5-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of three fluorine atoms and a methoxy group attached to a benzoic acid framework. The trifluoromethyl groups typically enhance the compound's lipophilicity and can influence its reactivity and biological activity. The methoxy group, being an electron-donating substituent, can affect the acidity of the carboxylic acid group, making it less acidic compared to unsubstituted benzoic acids. This compound is likely to be a solid at room temperature and may exhibit moderate solubility in organic solvents due to its polar functional groups. Its unique structure may confer specific properties, such as increased stability against oxidation and potential applications in pharmaceuticals or agrochemicals. The presence of fluorine atoms often imparts unique electronic properties, which can be beneficial in drug design and development. As with many fluorinated compounds, care should be taken regarding environmental and health impacts, as some fluorinated substances can persist in the environment.
Formula:C8H5F3O3
InChI:InChI=1/C8H5F3O3/c1-14-4-2-3(8(12)13)5(9)7(11)6(4)10/h2H,1H3,(H,12,13)
SMILES:COc1cc(c(c(c1F)F)F)C(=O)O
Synonyms:- Benzoic Acid, 2,3,4-Trifluoro-5-Methoxy-
- 5-Methoxy-2,3,4-trifluorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Methoxy-2,3,4-trifluorobenzoic acid
CAS:5-Methoxy-2,3,4-trifluorobenzoic acidFormula:C8H5F3O3Purity:98%Color and Shape:White to off white Solid-PowderMolecular weight:206.11872,3,4-Trifluoro-5-methoxybenzoic acid
CAS:Formula:C8H5F3O3Purity:98%Color and Shape:SolidMolecular weight:206.1187Ref: IN-DA00C76N
10gTo inquire25gTo inquire50gTo inquire100gTo inquire100mg52.00€250mg67.00€1g123.00€5g345.00€5-Methoxy-2,3,4-trifluorobenzoic acid
CAS:2,3,4-Trifluoro-5-methoxybenzoic acidFormula:C8H5F3O3Purity:98%Molecular weight:206.122,3,4-Trifluoro-5-methoxybenzoic Acid
CAS:Controlled ProductApplications 2,3,4-Trifluoro-5-methoxybenzoic Acid (cas# 38233-47-5) is a compound useful in organic synthesis.
Formula:C8H5F3O3Color and Shape:NeatMolecular weight:206.12





