CAS 38235-71-1
:3-Hydrazinobenzoic acid
Description:
3-Hydrazinobenzoic acid, with the CAS number 38235-71-1, is an organic compound characterized by the presence of both a hydrazine functional group and a carboxylic acid group attached to a benzene ring. This compound typically appears as a white to off-white crystalline solid. It is soluble in polar solvents such as water and alcohols, owing to the hydrophilic nature of the carboxylic acid and hydrazine moieties. The presence of the hydrazine group imparts potential reactivity, making it useful in various chemical syntheses and applications, including as a building block in pharmaceuticals and agrochemicals. Additionally, 3-hydrazinobenzoic acid may exhibit biological activity, which can be explored for potential therapeutic uses. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. As with many hydrazine derivatives, safety precautions should be taken due to potential toxicity and reactivity.
Formula:C7H8N2O2
InChI:InChI=1/C7H8N2O2/c8-9-6-3-1-2-5(4-6)7(10)11/h1-4,9H,8H2,(H,10,11)
InChI key:InChIKey=VBYDSMBICNUTKN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(NN)=CC=C1
Synonyms:- (3-Carboxyphenyl)hydrazine
- (m-Carboxyphenyl)hydrazine
- 3-Hydrazinobenzoicacid
- 3-Hydrazinylbenzoic acid
- Benzoic acid, 3-hydrazino-
- Benzoic acid, 3-hydrazinyl-
- Benzoic acid, m-hydrazino-
- m-Hydrazinobenzoic acid
- 3-HYDRAZINOBENZOIC ACID
- 3-Hydrazinobenzoicacid,99%
- 3-hydrazinobenzoic acid hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Hydrazinylbenzoic acid
CAS:3-Hydrazinylbenzoic acidFormula:C7H8N2O2Purity:98%Molecular weight:152.153-Hydrazinobenzoic acid
CAS:3-Hydrazinobenzoic acidFormula:C7H8N2O2Purity:93%Color and Shape:Light Tan SolidMolecular weight:152.150613-Hydrazinylbenzoic acid
CAS:Formula:C7H8N2O2Purity:98%Color and Shape:SolidMolecular weight:152.15063-Hydrazinobenzoic Acid
CAS:Formula:C7H8N2O2Purity:>97.0%(T)(HPLC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:152.153-Hydrazinobenzoic acid
CAS:3-Hydrazinobenzoic acid is a covalent inhibitor that binds to lysine residues of proteins and inhibits their activity. It can be immobilized in different materials such as polymers, hydrogels, and zeolites. 3-Hydrazinobenzoic acid has been used to treat autoimmune diseases and cancer. In wastewater treatment, it has been shown to remove chloride ions, which are toxic to microorganisms. 3-Hydrazinobenzoic acid also reduces the pH of the environment by reacting with hydrochloric acid or other acidic compounds.Formula:C7H8N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:152.15 g/mol3-Hydrazinylbenzoic acid
CAS:Formula:C7H8N2O2Purity:95.0%Color and Shape:SolidMolecular weight:152.153





