CAS 3824-74-6

Urea, N,N'-bis[3,5-bis(trifluoromethyl)phenyl]-

Description:

Urea, N,N'-bis[3,5-bis(trifluoromethyl)phenyl]- (CAS 3824-74-6) is an organic compound characterized by its urea functional group, which is central to its structure. This compound features two 3,5-bis(trifluoromethyl)phenyl groups attached to the nitrogen atoms of the urea moiety, contributing to its unique properties. The presence of trifluoromethyl groups enhances its lipophilicity and can influence its reactivity and interaction with biological systems. Urea derivatives are often utilized in various applications, including pharmaceuticals and agrochemicals, due to their ability to form hydrogen bonds and their relatively high stability. The compound is typically solid at room temperature and may exhibit low solubility in water, while being more soluble in organic solvents. Its fluorinated phenyl groups can impart significant electronic effects, making it of interest in materials science and medicinal chemistry. Safety data should be consulted for handling, as fluorinated compounds can have specific environmental and health considerations.

Formula: C₁₇H₈F₁₂N₂O

InChI: InChI=1S/C17H8F12N2O/c18-14(19,20)7-1-8(15(21,22)23)4-11(3-7)30-13(32)31-12-5-9(16(24,25)26)2-10(6-12)17(27,28)29/h1-6H,(H2,30,31,32)

InChI key: YGCOMBKZFUMALE-UHFFFAOYSA-N

SMILES: C1=C(C=C(C=C1C(F)(F)F)NC(=O)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)C(F)(F)F

1,3-Bis[3,5-Bis(Trifluoromethyl)Phenyl]Urea

CAS: 3824-74-6

1,3-Bis[3,5-Bis(Trifluoromethyl)Phenyl]Urea

Formula: C₁₇H₈F₁₂N₂O

Purity: 98%

Molecular weight: 484.24

Ref: 54-PC105047

N,N'-Bis[3,5-bis(trifluoromethyl)phenyl]urea

CAS: 3824-74-6

Formula: C₁₇H₈F₁₂N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 484.2391

Ref: IN-DA007ARE

Schreiner's Catalyst

CAS: 3824-74-6

1,3-Bis(3,5-bis(trifluoromethyl)phenyl)urea

Formula: C₁₇H₈F₁₂N₂O

Purity: 98%

Molecular weight: 484.24

Ref: IN-DG416374

Schreiner’s Catalyst

CAS: 3824-74-6

Purity: 98%

Molecular weight: 484.045

Ref: 10-F545269

1,3-Bis[3,5-bis(trifluoromethyl)phenyl]urea

CAS: 3824-74-6

1,3-Bis[3,5-bis(trifluoromethyl)phenyl]urea effectively activates the heme-regulated inhibitor of eIF2α kinase. It reduces the abundance of the eIF2·GTP·tRNAiMet ternary complex and can inhibit the proliferation of cancer cells.

Formula: C₁₇H₈F₁₂N₂O

Molecular weight: 484.2391

Ref: TM-T214156