CAS 38302-15-7

Formula: C18H18O5

InChI: InChI=1S/C18H18O5/c1-20-12-6-4-11(5-7-12)15-10-14(19)18-16(22-3)8-13(21-2)9-17(18)23-15/h4-9,15H,10H2,1-3H3

InChI key: MQFSCAHSIUPLSB-UHFFFAOYSA-N

SMILES: COC1=CC=C(C=C1)C2CC(=O)C3=C(O2)C=C(C=C3OC)OC

Naringenin trimethyl ether

CAS: 38302-15-7

Formula: C₁₈H₁₈O₅

Purity: 99%

Color and Shape: Solid

Molecular weight: 314.3325

Ref: IN-DA00CHVF

Naringenin trimethyl ether

CAS: 38302-15-7

Naringenin trimethyl ether

Formula: C₁₈H₁₈O₅

Purity: ≥98%

Molecular weight: 314.33

Ref: 54-BUP09965

Naringenin trimethyl ether

CAS: 38302-15-7

Formula: C₁₈H₁₈O₅

Molecular weight: 314.34

Ref: 7W-GY1544

Naringenin trimethyl ether

CAS: 38302-15-7

Formula: C₁₈H₁₈O₅

Purity: 95%~99%

Molecular weight: 314.337

Ref: BP-SBP00403

Diosmin Impurity 6

CAS: 38302-15-7

Formula: C₁₈H₁₈O₅

Molecular weight: 314.34

Ref: 4Z-D-4516

Naringenin trimethyl ether

CAS: 38302-15-7

Naringenin trimethyl ether is a flavonoid compound, which is typically derived from citrus fruits and other plant sources. This compound is part of the larger class of polyphenolic compounds known as flavonoids, which are prominent for their presence in various plant species, contributing to a variety of physiological activities.

Formula: C₁₈H₁₈O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 314.33 g/mol

Ref: 3D-XN161726

Naringenin trimethyl ether

CAS: 38302-15-7

Ref: BE-RMCD164008

Naringenin trimethyl ether

CAS: 38302-15-7

(S)-5,7-Dimethoxy-2-(4-methoxyphenyl)chroman-4-one

Formula: C₁₈H₁₈O₅

Purity: 99%

Molecular weight: 314.33

Ref: IN-DG235862

Naringenin trimethyl ether

CAS: 38302-15-7

1. Naringenin trimethyl ether (5,7,4'-Trimethoxyflavanone) shows significant molluscicidal activity with a median lethal concentration (LC(5)) of 3.9 μg/mL.

Formula: C₁₈H₁₈O₅

Purity: 99.91%

Color and Shape: Solid

Molecular weight: 314.33

Ref: TM-T2S2169