CAS 38350-87-7
:4-Heptylbenzoic acid
Description:
4-Heptylbenzoic acid, with the CAS number 38350-87-7, is an organic compound characterized by a benzoic acid structure with a heptyl group attached to the para position of the aromatic ring. This compound typically appears as a white to off-white solid and is soluble in organic solvents while exhibiting limited solubility in water due to its hydrophobic heptyl chain. The presence of the carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. 4-Heptylbenzoic acid is of interest in materials science, particularly in the development of liquid crystal materials and as a potential additive in polymer formulations. Its melting and boiling points, as well as other physical properties, can vary based on purity and environmental conditions. Overall, this compound is notable for its unique structure, which combines both hydrophobic and hydrophilic characteristics, making it useful in various chemical applications.
Formula:C14H20O2
InChI:InChI=1S/C14H20O2/c1-2-3-4-5-6-7-12-8-10-13(11-9-12)14(15)16/h8-11H,2-7H2,1H3,(H,15,16)
InChI key:InChIKey=VSUKEWPHURLYTK-UHFFFAOYSA-N
SMILES:C(CCCCCC)C1=CC=C(C(O)=O)C=C1
Synonyms:- 4-Heptyl-Benzoicaci
- 4-N-Heptylbenzoic Acid
- 4-n-Heptyl benzoic acid
- Benzoic acid, 4-heptyl-
- Labotest-Bb Lt00159036
- P-(N-Heptyl)Benzoic Acid
- P-Heptylbenzoic Acid
- Rarechem Al Bo 0756
- 4-Heptylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Heptylbenzoic Acid
CAS:Formula:C14H20O2Purity:>95.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:220.314-n-Heptylbenzoic acid, 99+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C14H20O2Purity:99+%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:220.314-Heptylbenzoic acid
CAS:4-Heptylbenzoic acidFormula:C14H20O2Purity:>98%Color and Shape:Solid-PowderMolecular weight:220.3074




