CAS 38380-02-8: PCB 87
Description:PCB 87, identified by its CAS number 38380-02-8, is a polychlorinated biphenyl (PCB) compound, which is part of a larger group of synthetic organic chemicals known for their environmental persistence and potential toxicity. PCBs are characterized by their biphenyl structure, where hydrogen atoms are replaced by chlorine atoms, leading to various chlorinated derivatives. PCB 87 specifically has a unique chlorine substitution pattern that influences its physical and chemical properties, such as solubility, volatility, and stability. Generally, PCBs are hydrophobic, making them more soluble in organic solvents than in water, and they tend to bioaccumulate in living organisms, raising concerns regarding their ecological and health impacts. Due to their carcinogenic potential and adverse effects on the immune, reproductive, and endocrine systems, PCBs have been banned or heavily regulated in many countries. PCB 87, like other PCBs, is subject to environmental monitoring and remediation efforts due to its persistence in the environment and potential for long-term ecological harm.
Formula:C12H5Cl5
InChI:InChI=1S/C12H5Cl5/c13-6-1-3-9(14)8(5-6)7-2-4-10(15)12(17)11(7)16/h1-5H
InChI key:InChIKey=OPKYDBFRKPQCBS-UHFFFAOYSA-N
SMILES:ClC1=CC=C(Cl)C(=C1)C=2C=CC(Cl)=C(Cl)C2Cl
- Synonyms:
- 1,1'-Biphenyl, 2,2',3,4,5'-Pentachloro-
- 1,1′-Biphenyl, 2,2′,3,4,5′-pentachloro-
- 2,2',3',4',5-Pentachlorobiphenyl
- 2,2',3,4,5'-Pcb
- 2,2',3,4,5'-Pentachloro-1,1'-biphenyl
- 2,2',3,4,5'-Pentachlorodiphenyl
- 2,2′,3,4,5′-Pentachloro-1,1′-biphenyl
- 2,2′,3,4,5′-Pentachlorobiphenyl
- 2,2′,3,4,5′-Pentachlorodiphenyl
- 2,3,4,2',5'-Pentachlorobiphenyl
- See more synonyms
- 2,3,4,2′,5′-Pentachlorobiphenyl
- 2,5,2',3',4'-Pentachlorobiphenyl
- 2,5,2′,3′,4′-Pentachlorobiphenyl
- 38380-02-8
- Pcb 87
- 2,2',3,4,5'-Pentachlorobiphenyl
