CAS 38380-03-9: PCB 110
Description:PCB 110, or 2,2',4,4'-tetrachlorobiphenyl, is a member of the polychlorinated biphenyl (PCB) family, which consists of organic compounds with two linked phenyl rings and multiple chlorine atoms attached. Characteristically, PCBs are known for their chemical stability, hydrophobicity, and resistance to degradation, making them persistent environmental pollutants. PCB 110 specifically has four chlorine atoms, which influence its physical and chemical properties, such as its melting point, boiling point, and solubility. It is typically a colorless to light yellow solid or viscous liquid, depending on temperature. PCBs, including PCB 110, have been widely used in electrical equipment, heat exchangers, and as additives in various industrial applications due to their insulating properties. However, they are also recognized for their toxicity and potential to bioaccumulate in the environment, leading to adverse health effects in humans and wildlife. Consequently, the production and use of PCBs have been largely banned or restricted in many countries.
Formula:C12H5Cl5
InChI:InChI=1S/C12H5Cl5/c13-7-2-1-6(5-10(7)16)11-8(14)3-4-9(15)12(11)17/h1-5H
InChI key:InChIKey=ARXHIJMGSIYYRZ-UHFFFAOYSA-N
SMILES:ClC=1C=CC(=CC1Cl)C=2C(Cl)=CC=C(Cl)C2Cl
- Synonyms:
- 1,1'-Biphenyl, 2,3,3',4',6-Pentachloro-
- 1,1′-Biphenyl, 2,3,3′,4′,6-pentachloro-
- 2',3,3',4,6'-Pentachlorobiphenyl
- 2,3,3',4',6-Pcb
- 2,3,3',4',6-Pentachloro-1,1'-biphenyl
- 2,3,3′,4′,6-Pentachloro-1,1′-biphenyl
- 2,3,3′,4′,6-Pentachlorobiphenyl
- 2,3,6,3',4'-Pentachlorobiphenyl
- 2,3,6,3′,4′-Pentachlorobiphenyl
- 3,4,2',3',6'-Pentachlorobiphenyl
- See more synonyms
- 3,4,2′,3′,6′-Pentachlorobiphenyl
- Pcb 110
