CAS 38385-95-4
:2-(Piperidin-4-yl)-1H-benzimidazole
Description:
2-(Piperidin-4-yl)-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a piperidine ring. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in polar solvents due to the presence of nitrogen atoms in both the piperidine and benzimidazole moieties. It may display biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the piperidine group can influence its pharmacokinetic properties, such as absorption and distribution. Additionally, the compound may participate in hydrogen bonding and other intermolecular interactions, which can affect its reactivity and stability. Its CAS number, 38385-95-4, allows for easy identification in chemical databases and literature. Overall, 2-(Piperidin-4-yl)-1H-benzimidazole is a compound of interest for further research and potential applications in various fields, including drug discovery and development.
Formula:C12H15N3
InChI:InChI=1/C12H15N3/c1-2-4-11-10(3-1)14-12(15-11)9-5-7-13-8-6-9/h1-4,9,13H,5-8H2,(H,14,15)
InChI key:InChIKey=HBOGHPAOOWUTLB-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)nc(C1CCNCC1)[nH]2
Synonyms:- 1H-benzimidazole, 2-(4-piperidinyl)-
- 2-(4-Piperidinyl)-1H-benzimidazol
- 2-(4-Piperidinyl)-1H-benzimidazole
- 2-(4-Piperidyl)-1H-benzimidazole
- 2-(Piperidin-4-yl)-1H-1,3-benzodiazole
- 2-(Piperidin-4-yl)-1H-benzo[d]imidazole
- 2-(Piperidin-4-yl)benzimidazole
- 2-Piperidin-4-Yl-1H-Benzoimidazole
- 4-(Benzimidazol-2-yl)piperidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-(4-Piperidinyl)benzimidazole
CAS:Formula:C12H15N3Purity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:201.272-(Piperidin-4-yl)-1H-benzimidazole
CAS:Formula:C12H15N3Purity:97%Color and Shape:SolidMolecular weight:201.26762-(4-Piperidyl)-1H-benzoimidazole
CAS:2-(4-Piperidyl)-1H-benzoimidazolePurity:98%Molecular weight:201.27g/mol2-(4-Piperidinyl)-1H-benzimidazole
CAS:Formula:C12H15N3Purity:97%Color and Shape:SolidMolecular weight:201.2732-Piperidin-4-yl-1H-benzimidazole
CAS:Controlled ProductApplications 2-Piperidin-4-yl-1H-benzimidazole is used as a reagent in the synthesis of 3-amino-1-(5-indanyloxy)-2-propanol derivatives as potent sodium channel blockers for the treatment of ischemic stroke. Also used as a reagent in the synthesis of 2,3,5-trisubstituted pyridine derivatives as potent Akt1/Akt2 dual inhibitors.
References Seki, M., et al.: Chem. Pharm. Bull., 60, 488 (2012); Zhao, Z., et al.: Bioorg. Med. Chem. Lett., 15, 905 (2005)Formula:C12H15N3Color and Shape:NeatMolecular weight:201.272-(Piperidin-4-yl)-1H-benzo[d]imidazole
CAS:2-(Piperidin-4-yl)-1H-benzo[d]imidazole is a useful organic compound for research related to life sciences. The catalog number is T66525 and the CAS number is 38385-95-4.Formula:C12H15N3Color and Shape:SolidMolecular weight:201.2676







