CAS 38444-73-4
:2,2',6-trichlorobiphenyl
Description:
2,2',6-Trichlorobiphenyl is a chlorinated biphenyl compound characterized by the presence of three chlorine atoms attached to the biphenyl structure. Specifically, the chlorine substituents are located at the 2, 2', and 6 positions of the biphenyl framework. This compound is part of a larger class of chemicals known as polychlorinated biphenyls (PCBs), which were widely used in industrial applications due to their chemical stability and insulating properties. 2,2',6-Trichlorobiphenyl is typically a colorless to pale yellow solid at room temperature and is insoluble in water but soluble in organic solvents. It exhibits high thermal stability and resistance to degradation, which contributes to environmental persistence. Due to its potential toxicity and environmental impact, particularly as an endocrine disruptor, the use of PCBs has been heavily regulated or banned in many countries. The compound can bioaccumulate in the food chain, raising concerns about its effects on human health and ecosystems.
Formula:C12H7Cl3
InChI:InChI=1/C12H7Cl3/c13-9-5-2-1-4-8(9)12-10(14)6-3-7-11(12)15/h1-7H
SMILES:c1ccc(c(c1)c1c(cccc1Cl)Cl)Cl
Synonyms:- 1,1'-Biphenyl, 2,2',6-Trichloro-
- 2,2',6-Pcb
- 2,2',6-Trichloro-1,1'-biphenyl
- 38444-73-4
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,2',6-Trichlorobiphenyl
CAS:Controlled Product<p>2,2',6-Trichlorobiphenyl is a polychlorinated biphenyl that is a developmental toxicant in animals and humans. It has been shown to cause cardiac myocyte hypertrophy and ventricular myocyte hypertrophy. 2,2',6-Trichlorobiphenyl inhibits the L-type Ca2+ current of cardiac ventricular myocytes and prolongs the action potential duration and repolarization phase. This leads to an increase in heart rate, which can result in tachycardia. 2,2',6-Trichlorobiphenyl is known to have an affinity for dopamine receptors, which may explain its effects on the heart.</p>Formula:C12H7Cl3Purity:Min. 95%Molecular weight:257.5 g/mol
