CAS 52663-77-1
:PCB 208
Description:
PCB 208, or polychlorinated biphenyl 208, is a member of the polychlorinated biphenyl (PCB) family, which consists of synthetic organic chemicals known for their environmental persistence and potential toxicity. PCB 208 is characterized by its complex structure, containing multiple chlorine atoms attached to biphenyl, which contributes to its chemical stability and hydrophobic nature. This compound is typically a colorless to light yellow solid or viscous liquid, depending on its concentration and formulation. PCB 208 is known for its high thermal stability and resistance to degradation, making it useful in various industrial applications, such as electrical equipment and heat transfer fluids. However, due to its environmental persistence and bioaccumulation potential, PCB 208 poses significant ecological and health risks, including endocrine disruption and carcinogenic effects. Regulatory measures have been implemented in many countries to limit the use and release of PCBs, including PCB 208, into the environment, reflecting growing concerns over their long-term impact on human health and ecosystems.
Formula:C12HCl9
InChI:InChI=1S/C12HCl9/c13-2-1-3(14)7(16)4(6(2)15)5-8(17)10(19)12(21)11(20)9(5)18/h1H
InChI key:InChIKey=XIFFTDRFWYFAPO-UHFFFAOYSA-N
SMILES:ClC1=C(C(Cl)=C(Cl)C(Cl)=C1Cl)C2=C(Cl)C(Cl)=CC(Cl)=C2Cl
Synonyms:- 1,1'-Biphenyl, 2,2',3,3',4,5,5',6,6'-Nonachloro-
- 1,1′-Biphenyl, 2,2′,3,3′,4,5,5′,6,6′-nonachloro-
- 2,2',3,3',4,5,5',6,6'-Nonachloro-1,1'-biphenyl
- 2,2',3,3',4,5,5',6,6'-Pcb
- 2,2′,3,3′,4,5,5′,6,6′-Nonachloro-1,1′-biphenyl
- 2,2′,3,3′,4,5,5′,6,6′-Nonachlorobiphenyl
- 2,3,4,5,6,2′,3′,5′,6′-Nonachlorobiphenyl
- 52663-77-1
- Pcb 208
- 2,2',3,3',4,5,5',6,6'-Nonachlorobiphenyl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
PCB No. 208 10 µg/mL in Isooctane
CAS:Controlled ProductFormula:C12HCl9Color and Shape:ColourlessMolecular weight:464.21

