CymitQuimica logo

CAS 38473-89-1

:

3-bromo-4-tert-butylbenzoic acid

Description:
3-Bromo-4-tert-butylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a tert-butyl group on a benzene ring. The bromine substituent is located at the meta position relative to the carboxylic acid group, while the tert-butyl group is situated at the para position. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, with limited solubility in water due to its hydrophobic tert-butyl group. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the bromine atom can serve as a site for further substitution reactions, making this compound versatile in synthetic organic chemistry. Its unique structure may also influence its physical properties, such as melting point and boiling point, as well as its reactivity and potential applications in pharmaceuticals, agrochemicals, or materials science.
Formula:C11H13BrO2
InChI:InChI=1/C11H13BrO2/c1-11(2,3)8-5-4-7(10(13)14)6-9(8)12/h4-6H,1-3H3,(H,13,14)
InChI key:SHBYNNKZVBDWRW-UHFFFAOYSA-N
SMILES:CC(C)(C)c1ccc(cc1Br)C(=O)O
Synonyms:
  • Benzoic Acid, 3-Bromo-4-(1,1-Dimethylethyl)-
  • 3-Bromo-4-tert-butylbenzoic acid
Found 4 products.