CymitQuimica logo

CAS 3855-95-6

:

2-chloro-1,3-benzothiazole-6-carboxylic acid

Description:
2-Chloro-1,3-benzothiazole-6-carboxylic acid is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features a carboxylic acid functional group and a chlorine atom at the 2-position of the benzothiazole moiety. It is typically a solid at room temperature and is soluble in polar organic solvents. The presence of the carboxylic acid group contributes to its acidic properties, while the chlorine substituent can influence its reactivity and potential applications in synthesis. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility as an intermediate in chemical synthesis. Its reactivity can be attributed to the electron-withdrawing nature of the chlorine atom and the acidic hydrogen of the carboxylic group, making it a versatile building block in organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H4ClNO2S
InChI:InChI=1/C8H4ClNO2S/c9-8-10-5-2-1-4(7(11)12)3-6(5)13-8/h1-3H,(H,11,12)
InChI key:QLAKWSXVXQRGDB-UHFFFAOYSA-N
SMILES:c1cc2c(cc1C(=O)O)sc(Cl)n2
Synonyms:
  • 6-Benzothiazolecarboxylic Acid, 2-Chloro-
Found 5 products.