CymitQuimica logo

CAS 38628-53-4

:

3-[4-(hydroxymethyl)phenyl]propan-1-ol

Description:
3-[4-(Hydroxymethyl)phenyl]propan-1-ol, with the CAS number 38628-53-4, is an organic compound characterized by its structure, which includes a propanol backbone and a phenyl group substituted with a hydroxymethyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits properties such as solubility in polar solvents like water and alcohols, which is attributed to the presence of the hydroxyl (-OH) functional group. The hydroxymethyl group enhances its reactivity, making it useful in various chemical reactions, including those involving nucleophilic substitutions. Additionally, this compound may have applications in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Its physical and chemical properties, such as boiling point, melting point, and reactivity, can vary based on the specific conditions and purity of the substance. Safety data should be consulted for handling and storage, as with any chemical compound.
Formula:C10H14O2
InChI:InChI=1/C10H14O2/c11-7-1-2-9-3-5-10(8-12)6-4-9/h3-6,11-12H,1-2,7-8H2
InChI key:HOLRRRVDKVZVNG-UHFFFAOYSA-N
SMILES:C(Cc1ccc(cc1)CO)CO
Found 1 products.