CAS 3863-11-4
:3,4-Difluoroaniline
Description:
3,4-Difluoroaniline is an aromatic amine characterized by the presence of two fluorine atoms positioned at the 3 and 4 positions on the aniline ring. Its molecular formula is C6H5F2N, and it features a benzene ring with an amino group (-NH2) that contributes to its reactivity and solubility in polar solvents. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. 3,4-Difluoroaniline is known for its applications in the synthesis of various pharmaceuticals, agrochemicals, and dyes, owing to its ability to undergo electrophilic substitution reactions. It is also of interest in materials science for its potential use in the development of fluorinated polymers. However, like many anilines, it may pose health risks, including toxicity and potential carcinogenicity, necessitating careful handling and appropriate safety measures during use. Its physical and chemical properties, such as boiling point, melting point, and solubility, can vary based on environmental conditions and specific formulations.
Formula:C6H5F2N
InChI:InChI=1S/C6H5F2N/c7-5-2-1-4(9)3-6(5)8/h1-3H,9H2
InChI key:InChIKey=AXNUZKSSQHTNPZ-UHFFFAOYSA-N
SMILES:FC1=C(F)C=CC(N)=C1
Synonyms:- 3,4-Difluoro Aniline
- 3,4-Difluorobenzenamine
- 3,4-Difluorophenylamine
- 4,5-Difluoroaniline
- Aniline, 3,4-difluoro-
- Benzenamine, 3,4-difluoro-
- N-methyl-N-(trifluoro-lambda~4~-sulfanyl)methanamine
- NSC 10296
- 3,4-Difluoroaniline
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3,4-Difluoroaniline
CAS:Formula:C6H5F2NPurity:>98.0%(GC)(T)Color and Shape:White or Colorless to Yellow powder to lump to clear liquidMolecular weight:129.113,4-Difluoroaniline
CAS:3,4-DifluoroanilineFormula:C6H5F2NPurity:97%Color and Shape:Yellow Solid-Low MeltMolecular weight:129.10743,4-Difluoroaniline
CAS:Controlled ProductApplications 3,4-Difluoroaniline was used to prepare thiourea-containing sorafenib analogs or fluorinated 2-(4-aminophenyl)benzothiazoles as potential antitumor agents.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Yao, J., et al.: Bioorg. Med. Chem., 20, 2923 (2012); Hutchinson, I., et al.: J. Med. Chem., 44, 1446 (2001)Formula:C6H5F2NColor and Shape:NeatMolecular weight:129.11
