CAS 38661-72-2
:1,3-Bis(isocyanatomethyl)cyclohexane
Description:
1,3-Bis(isocyanatomethyl)cyclohexane, with the CAS number 38661-72-2, is a chemical compound characterized by its two isocyanate functional groups attached to a cyclohexane ring. This compound is typically a colorless to pale yellow solid at room temperature and is known for its reactivity due to the presence of isocyanate groups, which can readily participate in various chemical reactions, including polymerization and cross-linking. It is often used in the production of polyurethane materials, adhesives, and coatings. The compound is also recognized for its potential health hazards; it can be toxic and irritating to the skin, eyes, and respiratory system, necessitating careful handling and appropriate safety measures during use. Additionally, it is important to note that isocyanates can undergo hydrolysis in the presence of moisture, leading to the formation of corresponding amines and carbon dioxide. Overall, 1,3-Bis(isocyanatomethyl)cyclohexane is a versatile intermediate in organic synthesis and materials science, but it requires stringent safety protocols due to its hazardous nature.
Formula:C10H14N2O2
InChI:InChI=1S/C10H14N2O2/c13-7-11-5-9-2-1-3-10(4-9)6-12-8-14/h9-10H,1-6H2
InChI key:InChIKey=XSCLFFBWRKTMTE-UHFFFAOYSA-N
SMILES:C(N=C=O)C1CC(CN=C=O)CCC1
Synonyms:- 1,3-Bis(isocyanatomethyl)cyclohexane (cis and trans- mixture)
- 1,3-Bis(methylisocyanate)cyclohexane
- 1,3-Di(isocyanatomethyl)cyclohexane
- 1,3-Dimethylcyclohexane ω,ω′-diisocyanate
- Cyclohexane, 1,3-bis(isocyanatomethyl)-
- Hydrogenated 1,3-XDI
- Hydrogenated m-XDI
- Hydrogenated m-xylylene diisocyanate
- Isocyanic acid 1,3-cyclohexylenedimethylene ester
- 1,3-Bis(isocyanatomethyl)cyclohexane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3-Bis(isocyanatomethyl)cyclohexane (cis- and trans- mixture)
CAS:Formula:C10H14N2O2Purity:>99.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:194.231,3-Bis(Isocyanatomethyl)Cyclohexane
CAS:1,3-Bis(Isocyanatomethyl)CyclohexaneFormula:C10H14N2O2Purity:99%Molecular weight:194.231,3-Bis(isocyanatomethyl)cyclohexane
CAS:Formula:C10H14N2O2Purity:99%Color and Shape:LiquidMolecular weight:194.23041,3-Bis(isocyanatomethyl)cyclohexane (cis- and trans- mixture)
CAS:1,3-Bis(isocyanatomethyl)cyclohexane is an organic compound that belongs to the group of isocyanates. It has a molecular weight of 208.1 and is soluble in water and alcohols. 1,3-Bis(isocyanatomethyl)cyclohexane has a maximum absorbance at uv wavelength of 265 nm and a maximum absorption coefficient at uv wavelength of 3.2×104 M-1 cm-1. This compound has been shown to be toxic to rats when administered in high doses (greater than 100 mg/kg). The toxicity studies have shown that the compound causes eye irritation, skin irritation, and respiratory tract irritation in rats. These effects are more pronounced when the chemical is mixed with trimethylolpropane, which is a polyol used as an additive for polyurethanes.Formula:C10H14N2O2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:194.23 g/mol



