CAS 38665-01-9: Neodiosmin
Description:Neodiosmin is a flavonoid glycoside, primarily derived from the citrus plant species, particularly from the bitter orange (Citrus aurantium). It is known for its potential health benefits, particularly in promoting vascular health and improving circulation. Neodiosmin is a dihydroflavone, which means it has a specific structure that contributes to its biological activity. The compound is often used in dietary supplements and herbal products due to its antioxidant properties and its role in supporting venous function. In terms of solubility, neodiosmin is generally soluble in organic solvents but has limited solubility in water. Its chemical structure includes a sugar moiety, which enhances its bioavailability and efficacy in biological systems. As a natural compound, neodiosmin is considered safe for consumption, although it is always advisable to consult with a healthcare professional before starting any new supplement regimen. Overall, neodiosmin represents a significant area of interest in both nutritional science and pharmacology due to its potential therapeutic effects.
Formula:C28H32O15
InChI:InChI=1S/C28H32O15/c1-10-21(33)23(35)25(37)27(39-10)43-26-24(36)22(34)19(9-29)42-28(26)40-12-6-14(31)20-15(32)8-17(41-18(20)7-12)11-3-4-16(38-2)13(30)5-11/h3-8,10,19,21-31,33-37H,9H2,1-2H3/t10-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1
InChI key:InChIKey=VCCNKWWXYVWTLT-CYZBKYQRSA-N
SMILES:O=C1C=C(OC2=CC(OC3OC(CO)C(O)C(O)C3OC4OC(C)C(O)C(O)C4O)=CC(O)=C12)C=5C=CC(OC)=C(O)C5
- Synonyms:
- 4H-1-Benzopyran-4-one, 7-[[2-O-(6-deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)-β-<smallcap>D</span>-glucopyranosyl]oxy]-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-
- 4′,5-Dihydroxylflavanone-7-O-α-<span class="text-smallcaps">L</smallcap>-rhamnosyl (1→2)-β-<smallcap>D</span>-glucopyranoside
- 7-[[2-O-(6-Deoxy-α-<span class="text-smallcaps">L</smallcap>-mannopyranosyl)-β-<smallcap>D</span>-glucopyranosyl]oxy]-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one
- Diosmetin-7-neohesperidoside
- Neodiosmin
- 4′,5-Dihydroxylflavanone-7-O-α-L-rhamnosyl (1→2)-β-D-glucopyranoside
- 7-[[2-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 7-[[2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-
