CymitQuimica logo

CAS 387350-79-0

:

N-cyclopropyl-N-piperidin-4-yl-3-(trifluoromethyl)benzenesulfonamide

Description:
N-cyclopropyl-N-piperidin-4-yl-3-(trifluoromethyl)benzenesulfonamide, with the CAS number 387350-79-0, is a chemical compound characterized by its complex structure, which includes a cyclopropyl group, a piperidine moiety, and a trifluoromethyl-substituted benzenesulfonamide. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity may vary. The presence of the trifluoromethyl group enhances lipophilicity and may influence the compound's pharmacokinetic properties. Additionally, the cyclopropyl and piperidine rings contribute to its steric and electronic characteristics, potentially affecting its interaction with biological targets. The sulfonamide functional group is known for its ability to form hydrogen bonds, which can be crucial for binding interactions in biological systems. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of novel therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C15H19F3N2O2S
InChI:InChI=1/C15H19F3N2O2S/c16-15(17,18)11-2-1-3-14(10-11)23(21,22)20(12-4-5-12)13-6-8-19-9-7-13/h1-3,10,12-13,19H,4-9H2
SMILES:c1cc(cc(c1)S(=O)(=O)N(C1CC1)C1CCNCC1)C(F)(F)F
Synonyms:
  • Benzenesulfonamide, N-cyclopropyl-N-4-piperidinyl-3-(trifluoromethyl)-
Found 2 products.