CAS 38736-77-5
:(3alpha)-3-hydroxylup-20(29)-en-28-oic acid
Description:
(3alpha)-3-hydroxylup-20(29)-en-28-oic acid, commonly known as lupeol, is a pentacyclic triterpenoid compound derived from various plant sources. It is characterized by its unique structure, which includes a hydroxyl group at the C-3 position and a double bond between C-20 and C-29. This compound exhibits a range of biological activities, including anti-inflammatory, antioxidant, and anticancer properties, making it of interest in pharmacological research. Lupeol is typically found in the resin of certain plants and has been studied for its potential therapeutic effects in various diseases. Its solubility is generally low in water but can dissolve in organic solvents, which is typical for many triterpenoids. The presence of the hydroxyl group contributes to its reactivity and interaction with biological systems. Overall, (3alpha)-3-hydroxylup-20(29)-en-28-oic acid is a significant compound in natural product chemistry with promising applications in medicine and health.
Formula:C30H48O3
InChI:InChI=1/C30H48O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-24,31H,1,8-17H2,2-7H3,(H,32,33)/t19-,20+,21-,22+,23+,24+,27-,28+,29+,30-/m0/s1
InChI key:QGJZLNKBHJESQX-ULZDWRHHSA-N
SMILES:CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)C(=O)O
Synonyms:- 3-Epi-Betulinic Acid
- Lup-20(29)-En-28-Oic Acid, 3-Hydroxy-, (3Alpha)-
- Epibetulinic acid
- (3alpha)-3-Hydroxylup-20(29)-en-28-oic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Epibetulinic acid
CAS:Epibetulinic acid reduces inflammation, suppressing NO and prostaglandin E2 in endotoxin-stimulated mouse macrophages.Formula:C30H48O3Purity:99.66%Color and Shape:White SolidMolecular weight:456.7003Ref: TM-T2S0765
100mgTo inquire1mg50.00€5mg110.00€1mL*10mM (DMSO)131.00€10mg166.00€25mg268.00€50mg396.00€(3α)-3-Hydroxylup-20(29)-en-28-oic acid
CAS:Formula:C30H48O3Purity:98%Color and Shape:SolidMolecular weight:456.7003Epibetulinic acid
CAS:Epibetulinic acid is a naturally occurring triterpenoid acid, which is a derivative of betulinic acid. This compound is primarily sourced from the bark of birch trees, specifically from the Betula genus. It is a pentacyclic compound characterized by its typical lupane skeleton. Epibetulinic acid is noted for its diverse biological activities, underscoring its potent mode of action as a modulator of various cellular pathways.
Formula:C30H48O3Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:456.7 g/mol






