CAS 38862-24-7
:Acrylic acid N-hydroxysuccinimide ester
Description:
Acrylic acid N-hydroxysuccinimide ester, with the CAS number 38862-24-7, is a chemical compound that serves as a reactive intermediate in organic synthesis, particularly in the formation of conjugates with biomolecules. This compound features an acrylic acid moiety, which provides it with the ability to undergo polymerization and participate in various chemical reactions, including Michael additions and nucleophilic substitutions. The N-hydroxysuccinimide (NHS) group enhances its reactivity towards amines, making it useful for coupling reactions in bioconjugation applications, such as labeling proteins or creating drug delivery systems. The NHS ester is known for its stability under physiological conditions, which allows for selective reactions with primary amines while minimizing side reactions. Additionally, acrylic acid N-hydroxysuccinimide ester is typically a colorless to pale yellow liquid, and it should be handled with care due to its potential reactivity and the need for appropriate safety measures during use. Overall, this compound is valuable in the fields of biochemistry and materials science for its versatility in forming stable linkages with various substrates.
Formula:C7H7NO4
InChI:InChI=1/C7H7NO4/c1-2-7(11)12-8-5(9)3-4-6(8)10/h2H,1,3-4H2
SMILES:C=CC(=O)ON1C(=O)CCC1=O
Synonyms:- N-Succinimidyl acrylate
- 2,5-Pyrrolidinedione, 1-((1-oxo-2-propenyl)oxy)-
- 1-(Acryloyloxy)Pyrrolidine-2,5-Dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-Succinimidyl Acrylate
CAS:Formula:C7H7NO4Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:169.142,5-Dioxopyrrolidin-1-yl acrylate
CAS:Formula:C7H7NO4Purity:97%Color and Shape:SolidMolecular weight:169.13482,5-Dioxopyrrolidin-1-yl acrylate
CAS:2,5-Dioxopyrrolidin-1-yl acrylateFormula:C7H7NO4Purity:98%Color and Shape:SolidMolecular weight:169.132,5-Dioxopyrrolidin-1-yl acrylate
CAS:Formula:C7H7NO4Purity:97%Color and Shape:SolidMolecular weight:169.136



