CymitQuimica logo

CAS 38875-76-2

:

4-chloro-6-methylpyridine-3-carbonitrile

Description:
4-Chloro-6-methylpyridine-3-carbonitrile is a heterocyclic organic compound characterized by its pyridine ring structure, which contains a chlorine atom and a methyl group at specific positions, along with a cyano group (-C≡N) attached to the carbon adjacent to the nitrogen in the ring. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. Its molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals, as the presence of the cyano group can enhance reactivity and facilitate further chemical modifications. The chlorine substituent can influence the compound's electronic properties and reactivity, making it a valuable intermediate in synthetic chemistry. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if not managed properly. Overall, 4-chloro-6-methylpyridine-3-carbonitrile is a versatile compound with significant implications in various chemical applications.
Formula:C7H5ClN2
InChI:InChI=1/C7H5ClN2/c1-5-2-7(8)6(3-9)4-10-5/h2,4H,1H3
InChI key:WAYNDJKNBVJWPH-UHFFFAOYSA-N
SMILES:Cc1cc(c(C#N)cn1)Cl
Synonyms:
  • 3-Pyridinecarbonitrile, 4-chloro-6-methyl-
Found 4 products.