CAS 389-58-2: 4H-cyclopenta[1,2-b:5,4-b']bisthiophene

Description:4H-cyclopenta[1,2-b:5,4-b']bisthiophene, with the CAS number 389-58-2, is a polycyclic aromatic compound characterized by its unique fused thiophene rings. This compound features a bicyclic structure that incorporates two thiophene units connected through a cyclopentane bridge, resulting in a planar and conjugated system. Its molecular structure contributes to its electronic properties, making it of interest in organic electronics, particularly in organic semiconductors and photovoltaic applications. The compound typically exhibits strong absorption in the UV-visible spectrum, indicating its potential for light-harvesting applications. Additionally, it is known for its stability and relatively high thermal resistance compared to other organic materials. The presence of sulfur atoms in the thiophene rings enhances its electron-donating capabilities, which can be advantageous in various chemical reactions and material applications. Overall, 4H-cyclopenta[1,2-b:5,4-b']bisthiophene is a significant compound in the field of organic chemistry and materials science due to its unique structural and electronic properties.

Formula:C₉H₆S₂

InChI:InChI=1/C9H6S2/c1-3-10-8-6(1)5-7-2-4-11-9(7)8/h1-4H,5H2

Synonyms:
4H-Cyclopenta(2,1-b:3,4-b')dithiophene
3,4-Dithia-7H-cyclopenta[a]pentalene
K0130

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4H-Cyclopenta[2,1-b:3,4-b']dithiophene REF: 3B-C3021CAS: 389-58-2	>97.0%(GC)	69.00 €~242.00 €	Mon 07 Apr 25
3,4-Dithia-7H-cyclopenta[a]pentalene REF: IN-DA00BXATCAS: 389-58-2	97%	To inquire	Mon 14 Apr 25
4H-Cyclopenta[1,2-B:5,4-B?]Dithiophene REF: 54-OR1011546CAS: 389-58-2	98%	32.00 €~1,464.00 €	Tue 15 Apr 25
4H-Cyclopenta[1,2-b:5,4-b']dithiophene REF: 10-F222546CAS: 389-58-2	95.0%	20.00 €~1,281.00 €	Thu 17 Apr 25
4H-Cyclopenta[2,1-b:3,4-b']dithiophene REF: 3D-FC13994CAS: 389-58-2	Min. 95%	105.00 €~1,707.00 €	Fri 25 Apr 25