CAS 389-58-2
:4H-cyclopenta[1,2-b:5,4-b']bisthiophene
Description:
4H-cyclopenta[1,2-b:5,4-b']bisthiophene, with the CAS number 389-58-2, is a polycyclic aromatic compound characterized by its unique fused thiophene rings. This compound features a bicyclic structure that incorporates two thiophene units connected through a cyclopentane bridge, resulting in a planar and conjugated system. Its molecular structure contributes to its electronic properties, making it of interest in organic electronics, particularly in organic semiconductors and photovoltaic applications. The compound typically exhibits strong absorption in the UV-visible spectrum, indicating its potential for light-harvesting applications. Additionally, it is known for its stability and relatively high thermal resistance compared to other organic materials. The presence of sulfur atoms in the thiophene rings enhances its electron-donating capabilities, which can be advantageous in various chemical reactions and material applications. Overall, 4H-cyclopenta[1,2-b:5,4-b']bisthiophene is a significant compound in the field of organic chemistry and materials science due to its unique structural and electronic properties.
Formula:C9H6S2
InChI:InChI=1/C9H6S2/c1-3-10-8-6(1)5-7-2-4-11-9(7)8/h1-4H,5H2
SMILES:c1csc2c1Cc1ccsc21
Synonyms:- 4H-Cyclopenta(2,1-b:3,4-b')dithiophene
- 3,4-Dithia-7H-cyclopenta[a]pentalene
- K0130
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4H-Cyclopenta[2,1-b:3,4-b']dithiophene
CAS:Formula:C9H6S2Purity:>97.0%(GC)Color and Shape:White to Light yellow to Dark green powder to crystalMolecular weight:178.274H-Cyclopenta[1,2-B:5,4-B']Dithiophene
CAS:4H-Cyclopenta[1,2-B:5,4-B']DithiopheneFormula:C9H6S2Purity:98%Color and Shape:SolidMolecular weight:178.273,4-Dithia-7H-cyclopenta[a]pentalene
CAS:Formula:C9H6S2Purity:98%Color and Shape:SolidMolecular weight:178.2739Ref: IN-DA00BXAT
25gTo inquire50gTo inquire100mg26.00€250mg34.00€1g75.00€5g199.00€10g360.00€100g2,773.00€250g6,003.00€500g10,617.00€4H-Cyclopenta[1,2-b:5,4-b’]dithiophene
CAS:Formula:C9H6S2Purity:95%Color and Shape:SolidMolecular weight:178.274H-Cyclopenta[2,1-b:3,4-b']dithiophene
CAS:4H-Cyclopenta[2,1-b:3,4-b']dithiophene is a molecule that has been shown to be photovoltaic. It has an optical absorption spectrum that peaks in the UV region and is able to absorb light from 300 to 400 nm. 4H-Cyclopenta[2,1-b:3,4-b']dithiophene can be fabricated into devices by means of cyclic voltammetry or other techniques. As a result of its high electron mobility and its ability to absorb visible light, this molecule may lead to high efficiency solar cells. Photovoltaic devices made with 4H-Cyclopenta[2,1-b:3,4-b']dithiophene have been shown to have efficiencies as high as 2%.Formula:C9H6S2Purity:Min. 95%Color and Shape:PowderMolecular weight:178.28 g/mol




