CymitQuimica logo

CAS 38922-74-6

:

Imidazo[1,2-a]pyridine, 2-(4-chlorophenyl)-

Description:
Imidazo[1,2-a]pyridine, 2-(4-chlorophenyl)-, with the CAS number 38922-74-6, is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features a 4-chlorophenyl substituent at the 2-position of the imidazo[1,2-a]pyridine structure, enhancing its potential for biological activity and interaction with various receptors. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The presence of the chlorine atom introduces electronegative characteristics, which can influence the compound's reactivity and polarity. Imidazo[1,2-a]pyridine derivatives are of interest in medicinal chemistry due to their potential pharmacological applications, including antimicrobial and anticancer activities. The compound's structure allows for various synthetic modifications, making it a versatile building block in drug development. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C13H9ClN2
InChI:InChI=1S/C13H9ClN2/c14-11-6-4-10(5-7-11)12-9-16-8-2-1-3-13(16)15-12/h1-9H
InChI key:NGGHEECJTVTTSO-UHFFFAOYSA-N
SMILES:C1=CC2=NC(=CN2C=C1)C3=CC=C(C=C3)Cl
Found 6 products.