CymitQuimica logo

CAS 38934-69-9

:

methyl 1-pentofuranosyl-1H-1,2,4-triazole-3-carboxylate

Description:
Methyl 1-pentofuranosyl-1H-1,2,4-triazole-3-carboxylate, identified by its CAS number 38934-69-9, is a chemical compound that features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound is characterized by its furanosyl moiety, indicating that it is derived from a pentose sugar, specifically a furanose form, which contributes to its biological activity and potential applications in medicinal chemistry. The presence of the carboxylate group suggests that it may exhibit acidic properties, influencing its solubility and reactivity. Methyl esters, like the one in this compound, are often used to enhance the lipophilicity of molecules, potentially improving their pharmacokinetic profiles. Additionally, the triazole structure is known for its role in various biological activities, including antifungal and antimicrobial properties. Overall, this compound may be of interest in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological effects and interactions.
Formula:C9H13N3O6
InChI:InChI=1/C9H13N3O6/c1-17-9(16)7-10-3-12(11-7)8-6(15)5(14)4(2-13)18-8/h3-6,8,13-15H,2H2,1H3
InChI key:RFJYLFZDYHCYNF-UAKXSSHOSA-N
SMILES:COC(=O)c1ncn(C2C(C(C(CO)O2)O)O)n1
Synonyms:
  • 1H-1,2,4-triazole-3-carboxylic acid, 1-pentofuranosyl-, methyl ester
Found 5 products.