CymitQuimica logo

CAS 39020-79-6

:

Allyloxyphtalimide

Description:
Allyloxyphtalimide is an organic compound characterized by its unique structure, which includes a phthalimide moiety substituted with an allyloxy group. This compound typically exhibits properties associated with both the phthalimide and allyl functional groups, such as moderate solubility in organic solvents and potential reactivity due to the presence of the allyl group. Allyloxyphtalimide may be utilized in various chemical applications, including as an intermediate in organic synthesis or in the development of polymers and pharmaceuticals. Its reactivity can be attributed to the allyl group, which can participate in various chemical reactions, including polymerization and substitution reactions. Additionally, the phthalimide structure can provide stability and enhance the compound's performance in specific applications. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe usage and compliance with regulatory standards. Overall, allyloxyphtalimide represents a versatile compound with potential applications in multiple fields of chemistry.
Formula:C11H9NO3
InChI:InChI=1/C11H9NO3/c1-2-7-15-12-10(13)8-5-3-4-6-9(8)11(12)14/h2-6H,1,7H2
InChI key:XVKREICBUWCANY-UHFFFAOYSA-N
SMILES:C=CCON1C(=O)c2ccccc2C1=O
Synonyms:
  • N-Allyloxyphtalimide
  • N-Allyloxyphthalimide
  • 2-(Allyloxy)-1H-Isoindole-1,3(2H)-Dione
  • 2-(prop-2-en-1-yloxy)-1H-isoindole-1,3(2H)-dione
Found 5 products.