CAS 39070-63-8
:3,4-Diaminobenzophenone
Description:
3,4-Diaminobenzophenone, with the CAS number 39070-63-8, is an organic compound characterized by its structure, which features a benzophenone core substituted with two amino groups at the 3 and 4 positions of one of the aromatic rings. This compound typically appears as a solid and is known for its potential applications in the fields of dyes, pigments, and pharmaceuticals due to its ability to participate in various chemical reactions. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic amines. The presence of amino groups contributes to its reactivity, allowing it to engage in electrophilic substitution reactions and form various derivatives. Additionally, 3,4-Diaminobenzophenone may exhibit biological activity, making it of interest in medicinal chemistry. However, safety considerations are important, as many aromatic amines can be toxic or carcinogenic, necessitating careful handling and usage in laboratory and industrial settings.
Formula:C13H12N2O
InChI:InChI=1S/C13H12N2O/c14-11-7-6-10(8-12(11)15)13(16)9-4-2-1-3-5-9/h1-8H,14-15H2
InChI key:InChIKey=RXCOGDYOZQGGMK-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(N)=C(N)C=C1)C2=CC=CC=C2
Synonyms:- (3,4-Diaminophenyl)phenylmethanone
- 1,2-Diamino-4-(phenylcarbonyl)benzene
- 2-Amino-4-benzoylaniline
- 3,4-Benzophenonediamine
- 4-Benzoyl-1,2-benzenediamine
- 4-Benzoyl-1,2-diaminobenzene
- 4-Benzoyl-1,2-phenylenediamine
- 4-Benzoyl-o-phenylenediamine
- Methanone, (3,4-diaminophenyl)phenyl-
- p-Benzoyl-o-phenylenediamine
- 3,4-Diaminobenzophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
3,4-Diaminobenzophenone
CAS:Formula:C13H12N2OPurity:>98.0%(GC)(T)Color and Shape:Light yellow to Brown to Dark green powder to crystalMolecular weight:212.253,4-Diaminobenzophenone
CAS:3,4-DiaminobenzophenoneFormula:C13H12N2OPurity:95%Color and Shape:Solid-PowderMolecular weight:212.24718(3,4-Diaminophenyl)(phenyl)methanone
CAS:Formula:C13H12N2OPurity:95%Color and Shape:SolidMolecular weight:212.24723,4-Diaminobenzophenone
CAS:Controlled ProductApplications 3,4-Diaminobenzophenone is used in the synthesis of 2-Amino-5(6)-benzoylbenzimidazole (A593760), which is a minor urinary metabolite of Mebendazole (M200500) in man. Mebendazole impurity.
References Leban, J., et al.: Bioorg. Med. Chem. Lett., 17, 5858 (2007),Formula:C13H12N2OColor and Shape:NeatMolecular weight:212.25(3,4-Diaminophenyl)(phenyl)methanone
CAS:Formula:C13H12N2OPurity:98%(HPLC);RGColor and Shape:SolidMolecular weight:212.2523,4-Diaminobenzophenone-d5
CAS:Controlled ProductFormula:C13D5H7N2OColor and Shape:NeatMolecular weight:217.2783,4-Diaminobenzophenone
CAS:3,4-Diaminobenzophenone is an unsymmetrical compound and a derivative of benzophenone. It is used in the synthesis of other organic compounds, such as pharmaceuticals. 3,4-Diaminobenzophenone is also used as a solubilizing agent for drugs that are insoluble in water. The molecular weight of 3,4-Diaminobenzophenone can be determined by gravimetric analysis or FTIR methods. 3,4-Diaminobenzophenone has been shown to have antioxidative properties. This molecule can bind to hydroxyl groups on biomolecules and protect them from oxidation by reactive oxygen species (ROS).Formula:C13H12N2OPurity:Min 98.5%Color and Shape:PowderMolecular weight:212.25 g/mol







